Petroselinic acid
| Names | |
|---|---|
| Preferred IUPAC name
(6Z)-Octadec-6-enoic acid | |
| Other names
(6Z)-Octadecenoic acid (Z)-Octadec-6-enoic acid cis-6-Octadecenoic acid cis-Δ6-Octadecenoic acid Petroselinic acid 18:1 cis-6 | |
| Identifiers | |
3D model (JSmol) |
|
| ChEBI | |
| ChemSpider | |
| ECHA InfoCard | 100.008.901 |
| EC Number |
|
| KEGG | |
PubChem CID |
|
| UNII | |
CompTox Dashboard (EPA) |
|
| |
| |
| Properties | |
| C18H34O2 | |
| Molar mass | 282.468 g·mol−1 |
| Appearance | White powder |
| Insoluble | |
| Solubility in methanol | Soluble |
| Hazards | |
| GHS labelling: | |
| Warning | |
| H315, H319, H335 | |
| P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
| Safety data sheet (SDS) | MSDS from Sigma-Aldrich |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references | |
Petroselinic acid is a fatty acid that occurs naturally in several animal and vegetable fats and oils. It is a white powder and is commercially available. In chemical terms, petroselinic acid is classified as a monounsaturated omega-12 fatty acid, abbreviated with a lipid number of 18:1 cis-6. It has the formula CH3(CH2)10CH=CH(CH2)4COOH. The term "petroselinic" means related to, or derived from, oil of Petroselinum, parsley. Despite its name, petroselinic acid does not contain any selenium. Petroselinic acid is a positional isomer of oleic acid.