Hydantoin

Hydantoin
Names
	Preferred IUPAC name Imidazolidine-2,4-dione
Identifiers
CAS Number	461-72-3 ;
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:27612 ;
ChEMBL	ChEMBL122334 ;
ChemSpider	9612 ;
ECHA InfoCard	100.006.650
KEGG	C05146 ;
PubChem CID	10006;
UNII	I6208298TA;
CompTox Dashboard (EPA)	DTXSID1052111 ;
	InChI InChI=1S/C3H4N2O2/c6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7) Key: WJRBRSLFGCUECM-UHFFFAOYSA-N ; InChI=1/C3H4N2O2/c6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7) Key: WJRBRSLFGCUECM-UHFFFAOYAD;
	SMILES O=C1NC(=O)NC1;
Properties
Chemical formula	C3H4N2O2
Molar mass	100.077 g·mol−1
Melting point	220 °C (428 °F; 493 K)
Solubility in water	39.7 g/l (100 °C)
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). verify (what is ?) Infobox references

Hydantoin, or glycolylurea, is a heterocyclic organic compound with the formula CH₂C(O)NHC(O)NH. It is a colorless solid that arises from the reaction of glycolic acid and urea. It is an oxidized derivative of imidazolidine. In a more general sense, hydantoins can refer to groups or a class of compounds with the same ring structure as the parent compound. For example, phenytoin (mentioned below) has two phenyl groups substituted onto the number 5 carbon in a hydantoin molecule.